Anion-directed crystallization of coordination polymers: syntheses and characterization of Cu(4)(2-pzc)(4)(H(2)O)(8)(Mo(8)O(26)).2H(2)O and Cu(3)(2-pzc)(4)(H(2)O)(2)(V(10)O(28)H(4)).6.5H(2)O (2-pzc = 2-pyrazinecarboxylate).

نویسندگان

  • L M Zheng
  • Y Wang
  • X Wang
  • J D Korp
  • A J Jacobson
چکیده

Two new copper 2-pyrazinecarboxylate (2-pzc) coordination polymers incorporating [Mo(8)O(26)](4-) and [V(10)O(28)H(4)](2-) anions were synthesized and structurally characterized: Cu(4)(2-pzc)(4))(H(2)O)(8)(Mo(8)O(26)).2H(2)O (1) and Cu(3)(2-pzc)(4)(H(2)O)(2)(V(10)O(28)H(4)).6.5H(2)O (2). Crystal data: 1, monoclinic, space group P2(1)/n, a = 11.1547(5) A, b = 13.4149(6) A, c = 15.9633(7) A, beta = 90.816(1) degrees; 2, triclinic, space group P1, a = 10.5896(10) A, b = 10.7921(10) A, c = 13.5168(13) A, alpha = 104.689(2) degrees, beta = 99.103(2) degrees, gamma = 113.419(2) degrees. Compound 1 contains [Cu(2-pzc)(H(2)O)(2)] chains charge-balanced by [Mo(8)O(26)](4-) anions. In compound 2, layers of [Cu(3)(2-pzc)(4)(H(2)O)(2)] form cavities that are filled with [V(10)O(28)H(4)](2-) anions. The magnetic properties of both compounds are described.

برای دانلود رایگان متن کامل این مقاله و بیش از 32 میلیون مقاله دیگر ابتدا ثبت نام کنید

ثبت نام

اگر عضو سایت هستید لطفا وارد حساب کاربری خود شوید

منابع مشابه

Poly[[hemi-μ4-oxalato-hemi-μ2-oxalato-bis­(μ3-pyrazine-2-carboxyl­ato)neodymium(III)silver(I)] monohydrate]

In the title coordination polymer, {[AgNd(C(5)H(3)N(2)O(2))(2)(C(2)O(4))]·H(2)O}(n), the Nd(III) atom is coordinated in a distorted monocapped square-anti-prismatic geometry by two O and two N atoms of two N,O-bidentate pyrazine-2-carboxyl-ate (2-pzc) ligands, four O atoms of two bidentate oxalate ligands, and one O atom of a monodentate carboxyl-ate group of a 2-pzc ligand. The Ag(I) ion is co...

متن کامل

Transition metal-induced self-assembly of small molybdenum clusters.

The first-row transition metals (TMs) are applied to induce the assembly of small molybdenum clusters (SMCs) in the molybdenum/TM/phosphate system, and eight SMC-based compounds are synthesized: [(V(2)O(2))(H(2)PMo(8)V(4)O(40))]·2(en)·12H(2)O (1), [CrMo(6)O(18)(OH)(6)]·1.5(H(2)en)·5H(2)O (2), [MnMo(12)O(24)(OH)(6)(HPO(4))(2)(PO(4))(6)]·7(H(2)en)·6H(2)O (3), {[Co(H(2)O)](2)[CoMo(12)O(24)(OH)(6)(...

متن کامل

Copper(II) 5-methoxyisophthalate coordination polymers incorporating dipyridyl co-ligands: syntheses, crystal structures, and magnetic properties.

Hydrothermal reactions of mixed ligands 5-methoxyisophthalate (CH(3)O-H(2)ip) and dipyridyl with Cu(OAc)(2).2H(2)O afford five new coordination polymers, including {[Cu(CH(3)O-ip)(bpa)].H(2)O}(n) (1), [Cu(2)(CH(3)O-ip)(2)(bpa)(0.5)(H(2)O)](n) (2), [Cu(2)(CH(3)O-ip)(2)(bpp)(H(2)O)](n) (3), {[Cu(3)(CH(3)O-ip)(3)(bpp)(2)(H(2)O)].3H(2)O}(n) (4) and [Cu(4)(CH(3)O-ip)(3)(bpe)(OH)(2)](n) (5) (bpp = 1,...

متن کامل

Coordination polymers of macrocyclic oxamide with 1,3,5-benzenetricarboxylate: syntheses, crystal structures and magnetic properties.

Solvothermal reactions of mixed ligands H(3)BTC and macrocyclic oxamide complexes (ML, M = Cu, Ni) with M(ClO(4))(2)·6H(2)O (M = Co, Zn, Ni and Cd) afford six new complexes, including [M'(4)(BTC)(2)(ML)(2)(OH)(2)(H(2)O)(2)]·2H(2)O (M' = Co, M = Ni, for (1); M' = Zn, M = Ni, for (2); M' = Zn, M = Cu, for (3)), [Ni(3)(BTC)(2)(NiL)(2)(H(2)O)(6)]·2CH(3)OH·2H(2)O (4), [Cd(4)(BTC)(2)(HBTC)(NiL)(4)(H(...

متن کامل

2D coordination polymers of macrocyclic oxamide with polycarboxylates: syntheses, crystal structures and magnetic properties.

Five new 2D coordination polymers, [Co(nip)(CuL)(H(2)O)]·CH(3)OH (1), [Mn(ip)(NiL)]·0.63H(2)O (2), [Cu(ip)(CuL)] (3), [Mn(6)(CuL)(6)(btc)(4)(H(2)O)(4)]·7H(2)O (4), and [Cu(CuL)(Hbtc)(H(2)O)] (5)(ML, H(2)L = 2,3-dioxo-5,6,14,15-dibenzo-1,4,8,12-tetraazacyclo-pentadeca-7,13-diene; H(2)nip = 5-nitroisophthalic acid; H(2)ip = m-isophthalic acid; H(3)btc = 1,3,5-benzenetricarboxylic acid) have been ...

متن کامل

ذخیره در منابع من

ذخیره در منابع من قبلا به منابع من ذحیره شده

{@ msg_add @}


  با ذخیره ی این منبع در منابع من، دسترسی به آن را برای استفاده های بعدی آسان تر کنید

عنوان ژورنال:
  • Inorganic chemistry

دوره 40 6  شماره 

صفحات  -

تاریخ انتشار 2001